C27H32N4O5S — CID 16546764
N'-[4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]benzoyl]-3,4,5-triethoxybenzohydrazide (PubChem CID 16546764) has the molecular formula C27H32N4O5S and a molecular weight of 524.64 g/mol. Its IUPAC name is N'-[4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]benzoyl]-3,4,5-triethoxybenzohydrazide.
| Compound Name | N'-[4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]benzoyl]-3,4,5-triethoxybenzohydrazide |
|---|---|
| PubChem CID | 16546764 |
| Molecular Formula | C27H32N4O5S |
| Molecular Weight | 524.64 g/mol |
| Exact Mass | 524.21 |
| IUPAC Name | N'-[4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]benzoyl]-3,4,5-triethoxybenzohydrazide |
| SMILES | CCOc1cc(C(=O)NNC(=O)c2ccc(CSc3nc(C)cc(C)n3)cc2)cc(OCC)c1OCC |
| InChI | InChI=1S/C27H32N4O5S/c1-6-34-22-14-21(15-23(35-7-2)24(22)36-8-3)26(33)31-30-25(32)20-11-9-19(10-12-20)16-37-27-28-17(4)13-18(5)29-27/h9-15H,6-8,16H2,1-5H3,(H,30,32)(H,31,33) |
| InChIKey | XVWBQUOKRSYKDT-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 111.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.64 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|