C29H26N4O4S — CID 16546797
N'-[2-(4-benzoylphenoxy)acetyl]-4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]benzohydrazide (PubChem CID 16546797) has the molecular formula C29H26N4O4S and a molecular weight of 526.62 g/mol. Its IUPAC name is N'-[2-(4-benzoylphenoxy)acetyl]-4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]benzohydrazide.
| Compound Name | N'-[2-(4-benzoylphenoxy)acetyl]-4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]benzohydrazide |
|---|---|
| PubChem CID | 16546797 |
| Molecular Formula | C29H26N4O4S |
| Molecular Weight | 526.62 g/mol |
| Exact Mass | 526.17 |
| IUPAC Name | N'-[2-(4-benzoylphenoxy)acetyl]-4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]benzohydrazide |
| SMILES | Cc1cc(C)nc(SCc2ccc(C(=O)NNC(=O)COc3ccc(C(=O)c4ccccc4)cc3)cc2)n1 |
| InChI | InChI=1S/C29H26N4O4S/c1-19-16-20(2)31-29(30-19)38-18-21-8-10-24(11-9-21)28(36)33-32-26(34)17-37-25-14-12-23(13-15-25)27(35)22-6-4-3-5-7-22/h3-16H,17-18H2,1-2H3,(H,32,34)(H,33,36) |
| InChIKey | SWZVKRDLHFFQPS-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.62 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|