C22H21ClN4O3S — CID 24535782
N'-[2-(4-chlorophenoxy)acetyl]-4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]benzohydrazide (PubChem CID 24535782) has the molecular formula C22H21ClN4O3S and a molecular weight of 456.96 g/mol. Its IUPAC name is N'-[2-(4-chlorophenoxy)acetyl]-4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]benzohydrazide.
| Compound Name | N'-[2-(4-chlorophenoxy)acetyl]-4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]benzohydrazide |
|---|---|
| PubChem CID | 24535782 |
| Molecular Formula | C22H21ClN4O3S |
| Molecular Weight | 456.96 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | N'-[2-(4-chlorophenoxy)acetyl]-4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]benzohydrazide |
| SMILES | Cc1cc(C)nc(SCc2ccc(C(=O)NNC(=O)COc3ccc(Cl)cc3)cc2)n1 |
| InChI | InChI=1S/C22H21ClN4O3S/c1-14-11-15(2)25-22(24-14)31-13-16-3-5-17(6-4-16)21(29)27-26-20(28)12-30-19-9-7-18(23)8-10-19/h3-11H,12-13H2,1-2H3,(H,26,28)(H,27,29) |
| InChIKey | SXENWZMJALWITA-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.96 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|