C24H26N4O3S2 — CID 55833566
4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]-N'-[2-(4-methoxyphenyl)sulfanylpropanoyl]benzohydrazide (PubChem CID 55833566) has the molecular formula C24H26N4O3S2 and a molecular weight of 482.63 g/mol. Its IUPAC name is 4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]-N'-[2-(4-methoxyphenyl)sulfanylpropanoyl]benzohydrazide.
| Compound Name | 4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]-N'-[2-(4-methoxyphenyl)sulfanylpropanoyl]benzohydrazide |
|---|---|
| PubChem CID | 55833566 |
| Molecular Formula | C24H26N4O3S2 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | 4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]-N'-[2-(4-methoxyphenyl)sulfanylpropanoyl]benzohydrazide |
| SMILES | COc1ccc(SC(C)C(=O)NNC(=O)c2ccc(CSc3nc(C)cc(C)n3)cc2)cc1 |
| InChI | InChI=1S/C24H26N4O3S2/c1-15-13-16(2)26-24(25-15)32-14-18-5-7-19(8-6-18)23(30)28-27-22(29)17(3)33-21-11-9-20(31-4)10-12-21/h5-13,17H,14H2,1-4H3,(H,27,29)(H,28,30) |
| InChIKey | CUASQYKRYOAYNG-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|