C21H22N4O2S2 — CID 60564442
N'-[4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]benzoyl]-3-ethylthiophene-2-carbohydrazide (PubChem CID 60564442) has the molecular formula C21H22N4O2S2 and a molecular weight of 426.57 g/mol. Its IUPAC name is N'-[4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]benzoyl]-3-ethylthiophene-2-carbohydrazide.
| Compound Name | N'-[4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]benzoyl]-3-ethylthiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 60564442 |
| Molecular Formula | C21H22N4O2S2 |
| Molecular Weight | 426.57 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | N'-[4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]benzoyl]-3-ethylthiophene-2-carbohydrazide |
| SMILES | CCc1ccsc1C(=O)NNC(=O)c1ccc(CSc2nc(C)cc(C)n2)cc1 |
| InChI | InChI=1S/C21H22N4O2S2/c1-4-16-9-10-28-18(16)20(27)25-24-19(26)17-7-5-15(6-8-17)12-29-21-22-13(2)11-14(3)23-21/h5-11H,4,12H2,1-3H3,(H,24,26)(H,25,27) |
| InChIKey | DYXBRUYWUYMOFK-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.57 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|