C22H20N4O4S — CID 55837240
N'-[4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]benzoyl]-1,3-benzodioxole-4-carbohydrazide (PubChem CID 55837240) has the molecular formula C22H20N4O4S and a molecular weight of 436.49 g/mol. Its IUPAC name is N'-[4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]benzoyl]-1,3-benzodioxole-4-carbohydrazide.
| Compound Name | N'-[4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]benzoyl]-1,3-benzodioxole-4-carbohydrazide |
|---|---|
| PubChem CID | 55837240 |
| Molecular Formula | C22H20N4O4S |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | N'-[4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]benzoyl]-1,3-benzodioxole-4-carbohydrazide |
| SMILES | Cc1cc(C)nc(SCc2ccc(C(=O)NNC(=O)c3cccc4c3OCO4)cc2)n1 |
| InChI | InChI=1S/C22H20N4O4S/c1-13-10-14(2)24-22(23-13)31-11-15-6-8-16(9-7-15)20(27)25-26-21(28)17-4-3-5-18-19(17)30-12-29-18/h3-10H,11-12H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | AOORHJRZTSKBNK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|