C23H24N4O2S2 — CID 24535754
N'-[4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]benzoyl]-4-(methylsulfanylmethyl)benzohydrazide (PubChem CID 24535754) has the molecular formula C23H24N4O2S2 and a molecular weight of 452.61 g/mol. Its IUPAC name is N'-[4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]benzoyl]-4-(methylsulfanylmethyl)benzohydrazide.
| Compound Name | N'-[4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]benzoyl]-4-(methylsulfanylmethyl)benzohydrazide |
|---|---|
| PubChem CID | 24535754 |
| Molecular Formula | C23H24N4O2S2 |
| Molecular Weight | 452.61 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | N'-[4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]benzoyl]-4-(methylsulfanylmethyl)benzohydrazide |
| SMILES | CSCc1ccc(C(=O)NNC(=O)c2ccc(CSc3nc(C)cc(C)n3)cc2)cc1 |
| InChI | InChI=1S/C23H24N4O2S2/c1-15-12-16(2)25-23(24-15)31-14-18-6-10-20(11-7-18)22(29)27-26-21(28)19-8-4-17(5-9-19)13-30-3/h4-12H,13-14H2,1-3H3,(H,26,28)(H,27,29) |
| InChIKey | USXKNFOUGMAEQS-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.61 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|