C20H20N4OS2 — CID 2457781
4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]-N'-(1-thiophen-2-ylethenyl)benzohydrazide (PubChem CID 2457781) has the molecular formula C20H20N4OS2 and a molecular weight of 396.54 g/mol. Its IUPAC name is 4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]-N'-(1-thiophen-2-ylethenyl)benzohydrazide.
| Compound Name | 4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]-N'-(1-thiophen-2-ylethenyl)benzohydrazide |
|---|---|
| PubChem CID | 2457781 |
| Molecular Formula | C20H20N4OS2 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | 4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]-N'-(1-thiophen-2-ylethenyl)benzohydrazide |
| SMILES | C=C(NNC(=O)c1ccc(CSc2nc(C)cc(C)n2)cc1)c1cccs1 |
| InChI | InChI=1S/C20H20N4OS2/c1-13-11-14(2)22-20(21-13)27-12-16-6-8-17(9-7-16)19(25)24-23-15(3)18-5-4-10-26-18/h4-11,23H,3,12H2,1-2H3,(H,24,25) |
| InChIKey | DMPNZZNLQUBMBB-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|