C24H23N5O3S2 — CID 24535828
N'-[2-(1,3-benzothiazol-2-ylmethoxy)acetyl]-4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]benzohydrazide (PubChem CID 24535828) has the molecular formula C24H23N5O3S2 and a molecular weight of 493.61 g/mol. Its IUPAC name is N'-[2-(1,3-benzothiazol-2-ylmethoxy)acetyl]-4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]benzohydrazide.
| Compound Name | N'-[2-(1,3-benzothiazol-2-ylmethoxy)acetyl]-4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]benzohydrazide |
|---|---|
| PubChem CID | 24535828 |
| Molecular Formula | C24H23N5O3S2 |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | N'-[2-(1,3-benzothiazol-2-ylmethoxy)acetyl]-4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]benzohydrazide |
| SMILES | Cc1cc(C)nc(SCc2ccc(C(=O)NNC(=O)COCc3nc4ccccc4s3)cc2)n1 |
| InChI | InChI=1S/C24H23N5O3S2/c1-15-11-16(2)26-24(25-15)33-14-17-7-9-18(10-8-17)23(31)29-28-21(30)12-32-13-22-27-19-5-3-4-6-20(19)34-22/h3-11H,12-14H2,1-2H3,(H,28,30)(H,29,31) |
| InChIKey | XCHRNSHBHKCWSL-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 106.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|