C22H20ClFN4O3S — CID 24535807
N'-[2-(2-chloro-4-fluorophenoxy)acetyl]-4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]benzohydrazide (PubChem CID 24535807) has the molecular formula C22H20ClFN4O3S and a molecular weight of 474.95 g/mol. Its IUPAC name is N'-[2-(2-chloro-4-fluorophenoxy)acetyl]-4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]benzohydrazide.
| Compound Name | N'-[2-(2-chloro-4-fluorophenoxy)acetyl]-4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]benzohydrazide |
|---|---|
| PubChem CID | 24535807 |
| Molecular Formula | C22H20ClFN4O3S |
| Molecular Weight | 474.95 g/mol |
| Exact Mass | 474.09 |
| IUPAC Name | N'-[2-(2-chloro-4-fluorophenoxy)acetyl]-4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]benzohydrazide |
| SMILES | Cc1cc(C)nc(SCc2ccc(C(=O)NNC(=O)COc3ccc(F)cc3Cl)cc2)n1 |
| InChI | InChI=1S/C22H20ClFN4O3S/c1-13-9-14(2)26-22(25-13)32-12-15-3-5-16(6-4-15)21(30)28-27-20(29)11-31-19-8-7-17(24)10-18(19)23/h3-10H,11-12H2,1-2H3,(H,27,29)(H,28,30) |
| InChIKey | ROFQMWLYLHHKRQ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.95 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|