C15H10Cl3FN2O3 — CID 7946113
4-fluoro-N'-[2-(2,4,5-trichlorophenoxy)acetyl]benzohydrazide (PubChem CID 7946113) has the molecular formula C15H10Cl3FN2O3 and a molecular weight of 391.61 g/mol. Its IUPAC name is 4-fluoro-N'-[2-(2,4,5-trichlorophenoxy)acetyl]benzohydrazide.
| Compound Name | 4-fluoro-N'-[2-(2,4,5-trichlorophenoxy)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 7946113 |
| Molecular Formula | C15H10Cl3FN2O3 |
| Molecular Weight | 391.61 g/mol |
| Exact Mass | 389.97 |
| IUPAC Name | 4-fluoro-N'-[2-(2,4,5-trichlorophenoxy)acetyl]benzohydrazide |
| SMILES | O=C(COc1cc(Cl)c(Cl)cc1Cl)NNC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H10Cl3FN2O3/c16-10-5-12(18)13(6-11(10)17)24-7-14(22)20-21-15(23)8-1-3-9(19)4-2-8/h1-6H,7H2,(H,20,22)(H,21,23) |
| InChIKey | NNWONOKAVYCITP-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.61 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|