C15H10Cl3NO3 — CID 2571070
N-[2-(2,4,5-trichlorophenoxy)acetyl]benzamide (PubChem CID 2571070) has the molecular formula C15H10Cl3NO3 and a molecular weight of 358.61 g/mol. Its IUPAC name is N-[2-(2,4,5-trichlorophenoxy)acetyl]benzamide.
| Compound Name | N-[2-(2,4,5-trichlorophenoxy)acetyl]benzamide |
|---|---|
| PubChem CID | 2571070 |
| Molecular Formula | C15H10Cl3NO3 |
| Molecular Weight | 358.61 g/mol |
| Exact Mass | 356.97 |
| IUPAC Name | N-[2-(2,4,5-trichlorophenoxy)acetyl]benzamide |
| SMILES | O=C(COc1cc(Cl)c(Cl)cc1Cl)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C15H10Cl3NO3/c16-10-6-12(18)13(7-11(10)17)22-8-14(20)19-15(21)9-4-2-1-3-5-9/h1-7H,8H2,(H,19,20,21) |
| InChIKey | XKWBRMRXCJUABP-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.61 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|