C20H14Cl3NO2 — CID 7929959
N-(2-phenylphenyl)-2-(2,4,5-trichlorophenoxy)acetamide (PubChem CID 7929959) has the molecular formula C20H14Cl3NO2 and a molecular weight of 406.70 g/mol. Its IUPAC name is N-(2-phenylphenyl)-2-(2,4,5-trichlorophenoxy)acetamide.
| Compound Name | N-(2-phenylphenyl)-2-(2,4,5-trichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 7929959 |
| Molecular Formula | C20H14Cl3NO2 |
| Molecular Weight | 406.70 g/mol |
| Exact Mass | 405.01 |
| IUPAC Name | N-(2-phenylphenyl)-2-(2,4,5-trichlorophenoxy)acetamide |
| SMILES | O=C(COc1cc(Cl)c(Cl)cc1Cl)Nc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C20H14Cl3NO2/c21-15-10-17(23)19(11-16(15)22)26-12-20(25)24-18-9-5-4-8-14(18)13-6-2-1-3-7-13/h1-11H,12H2,(H,24,25) |
| InChIKey | JPWKPIHMEGQHDN-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.70 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|