C19H17Cl3N4O2 — CID 60559768
N-[2-(5-propan-2-yl-1H-1,2,4-triazol-3-yl)phenyl]-2-(2,4,5-trichlorophenoxy)acetamide (PubChem CID 60559768) has the molecular formula C19H17Cl3N4O2 and a molecular weight of 439.73 g/mol. Its IUPAC name is N-[2-(5-propan-2-yl-1H-1,2,4-triazol-3-yl)phenyl]-2-(2,4,5-trichlorophenoxy)acetamide.
| Compound Name | N-[2-(5-propan-2-yl-1H-1,2,4-triazol-3-yl)phenyl]-2-(2,4,5-trichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 60559768 |
| Molecular Formula | C19H17Cl3N4O2 |
| Molecular Weight | 439.73 g/mol |
| Exact Mass | 438.04 |
| IUPAC Name | N-[2-(5-propan-2-yl-1H-1,2,4-triazol-3-yl)phenyl]-2-(2,4,5-trichlorophenoxy)acetamide |
| SMILES | CC(C)c1nc(-c2ccccc2NC(=O)COc2cc(Cl)c(Cl)cc2Cl)n[nH]1 |
| InChI | InChI=1S/C19H17Cl3N4O2/c1-10(2)18-24-19(26-25-18)11-5-3-4-6-15(11)23-17(27)9-28-16-8-13(21)12(20)7-14(16)22/h3-8,10H,9H2,1-2H3,(H,23,27)(H,24,25,26) |
| InChIKey | IQNGXWZJTYELRL-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.73 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|