C22H25N5O — CID 167839928
N-[2-(5-propan-2-yl-1H-1,2,4-triazol-3-yl)phenyl]-2-[(3S)-1,2,3,4-tetrahydroisoquinolin-3-yl]acetamide (PubChem CID 167839928) has the molecular formula C22H25N5O and a molecular weight of 375.48 g/mol. Its IUPAC name is N-[2-(5-propan-2-yl-1H-1,2,4-triazol-3-yl)phenyl]-2-[(3S)-1,2,3,4-tetrahydroisoquinolin-3-yl]acetamide.
| Compound Name | N-[2-(5-propan-2-yl-1H-1,2,4-triazol-3-yl)phenyl]-2-[(3S)-1,2,3,4-tetrahydroisoquinolin-3-yl]acetamide |
|---|---|
| PubChem CID | 167839928 |
| Molecular Formula | C22H25N5O |
| Molecular Weight | 375.48 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | N-[2-(5-propan-2-yl-1H-1,2,4-triazol-3-yl)phenyl]-2-[(3S)-1,2,3,4-tetrahydroisoquinolin-3-yl]acetamide |
| SMILES | CC(C)c1nc(-c2ccccc2NC(=O)C[C@@H]2Cc3ccccc3CN2)n[nH]1 |
| InChI | InChI=1S/C22H25N5O/c1-14(2)21-25-22(27-26-21)18-9-5-6-10-19(18)24-20(28)12-17-11-15-7-3-4-8-16(15)13-23-17/h3-10,14,17,23H,11-13H2,1-2H3,(H,24,28)(H,25,26,27)/t17-/m0/s1 |
| InChIKey | BZXSJSPAAOJMLC-KRWDZBQOSA-N |
| XLogP | 3.64 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.48 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |