C14H18N4O — CID 47423979
2-methyl-N-[2-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]butanamide (PubChem CID 47423979) has the molecular formula C14H18N4O and a molecular weight of 258.32 g/mol. Its IUPAC name is 2-methyl-N-[2-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]butanamide.
| Compound Name | 2-methyl-N-[2-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]butanamide |
|---|---|
| PubChem CID | 47423979 |
| Molecular Formula | C14H18N4O |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 2-methyl-N-[2-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]butanamide |
| SMILES | CCC(C)C(=O)Nc1ccccc1-c1n[nH]c(C)n1 |
| InChI | InChI=1S/C14H18N4O/c1-4-9(2)14(19)16-12-8-6-5-7-11(12)13-15-10(3)17-18-13/h5-9H,4H2,1-3H3,(H,16,19)(H,15,17,18) |
| InChIKey | UWHRGSOZAUGRMD-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |