C14H19N5O — CID 60841888
4-(methylamino)-N-[2-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]butanamide (PubChem CID 60841888) has the molecular formula C14H19N5O and a molecular weight of 273.34 g/mol. Its IUPAC name is 4-(methylamino)-N-[2-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]butanamide.
| Compound Name | 4-(methylamino)-N-[2-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]butanamide |
|---|---|
| PubChem CID | 60841888 |
| Molecular Formula | C14H19N5O |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | 4-(methylamino)-N-[2-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]butanamide |
| SMILES | CNCCCC(=O)Nc1ccccc1-c1n[nH]c(C)n1 |
| InChI | InChI=1S/C14H19N5O/c1-10-16-14(19-18-10)11-6-3-4-7-12(11)17-13(20)8-5-9-15-2/h3-4,6-7,15H,5,8-9H2,1-2H3,(H,17,20)(H,16,18,19) |
| InChIKey | NJLFDBNEHVSOCD-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|