C13H14N4O3 — CID 114897949
2-methyl-3-[2-(5-methyl-1H-1,2,4-triazol-3-yl)anilino]-3-oxopropanoic acid (PubChem CID 114897949) has the molecular formula C13H14N4O3 and a molecular weight of 274.28 g/mol. Its IUPAC name is 2-methyl-3-[2-(5-methyl-1H-1,2,4-triazol-3-yl)anilino]-3-oxopropanoic acid.
| Compound Name | 2-methyl-3-[2-(5-methyl-1H-1,2,4-triazol-3-yl)anilino]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 114897949 |
| Molecular Formula | C13H14N4O3 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 2-methyl-3-[2-(5-methyl-1H-1,2,4-triazol-3-yl)anilino]-3-oxopropanoic acid |
| SMILES | Cc1nc(-c2ccccc2NC(=O)C(C)C(=O)O)n[nH]1 |
| InChI | InChI=1S/C13H14N4O3/c1-7(13(19)20)12(18)15-10-6-4-3-5-9(10)11-14-8(2)16-17-11/h3-7H,1-2H3,(H,15,18)(H,19,20)(H,14,16,17) |
| InChIKey | QBUGCNQXFIWSSY-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|