C14H16N4O3 — CID 60942165
5-[2-(5-methyl-1H-1,2,4-triazol-3-yl)anilino]-5-oxopentanoic acid (PubChem CID 60942165) has the molecular formula C14H16N4O3 and a molecular weight of 288.31 g/mol. Its IUPAC name is 5-[2-(5-methyl-1H-1,2,4-triazol-3-yl)anilino]-5-oxopentanoic acid.
| Compound Name | 5-[2-(5-methyl-1H-1,2,4-triazol-3-yl)anilino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 60942165 |
| Molecular Formula | C14H16N4O3 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 5-[2-(5-methyl-1H-1,2,4-triazol-3-yl)anilino]-5-oxopentanoic acid |
| SMILES | Cc1nc(-c2ccccc2NC(=O)CCCC(=O)O)n[nH]1 |
| InChI | InChI=1S/C14H16N4O3/c1-9-15-14(18-17-9)10-5-2-3-6-11(10)16-12(19)7-4-8-13(20)21/h2-3,5-6H,4,7-8H2,1H3,(H,16,19)(H,20,21)(H,15,17,18) |
| InChIKey | SHRZOENRBONCRU-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |