C14H9Cl3INO2 — CID 21212586
N-(2-iodophenyl)-2-(2,4,5-trichlorophenoxy)acetamide (PubChem CID 21212586) has the molecular formula C14H9Cl3INO2 and a molecular weight of 456.49 g/mol. Its IUPAC name is N-(2-iodophenyl)-2-(2,4,5-trichlorophenoxy)acetamide.
| Compound Name | N-(2-iodophenyl)-2-(2,4,5-trichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 21212586 |
| Molecular Formula | C14H9Cl3INO2 |
| Molecular Weight | 456.49 g/mol |
| Exact Mass | 454.87 |
| IUPAC Name | N-(2-iodophenyl)-2-(2,4,5-trichlorophenoxy)acetamide |
| SMILES | O=C(COc1cc(Cl)c(Cl)cc1Cl)Nc1ccccc1I |
| InChI | InChI=1S/C14H9Cl3INO2/c15-8-5-10(17)13(6-9(8)16)21-7-14(20)19-12-4-2-1-3-11(12)18/h1-6H,7H2,(H,19,20) |
| InChIKey | NCAIYXAMFXPXAC-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.49 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|