C18H20INO2 — CID 36678366
2-(2-tert-butylphenoxy)-N-(2-iodophenyl)acetamide (PubChem CID 36678366) has the molecular formula C18H20INO2 and a molecular weight of 409.27 g/mol. Its IUPAC name is 2-(2-tert-butylphenoxy)-N-(2-iodophenyl)acetamide.
| Compound Name | 2-(2-tert-butylphenoxy)-N-(2-iodophenyl)acetamide |
|---|---|
| PubChem CID | 36678366 |
| Molecular Formula | C18H20INO2 |
| Molecular Weight | 409.27 g/mol |
| Exact Mass | 409.05 |
| IUPAC Name | 2-(2-tert-butylphenoxy)-N-(2-iodophenyl)acetamide |
| SMILES | CC(C)(C)c1ccccc1OCC(=O)Nc1ccccc1I |
| InChI | InChI=1S/C18H20INO2/c1-18(2,3)13-8-4-7-11-16(13)22-12-17(21)20-15-10-6-5-9-14(15)19/h4-11H,12H2,1-3H3,(H,20,21) |
| InChIKey | YAUBMYKWMKBRQW-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.27 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|