C21H22F3NO4 — CID 8701075
[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 2-(2-tert-butylphenoxy)acetate (PubChem CID 8701075) has the molecular formula C21H22F3NO4 and a molecular weight of 409.40 g/mol. Its IUPAC name is [2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 2-(2-tert-butylphenoxy)acetate.
| Compound Name | [2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 2-(2-tert-butylphenoxy)acetate |
|---|---|
| PubChem CID | 8701075 |
| Molecular Formula | C21H22F3NO4 |
| Molecular Weight | 409.40 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | [2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 2-(2-tert-butylphenoxy)acetate |
| SMILES | CC(C)(C)c1ccccc1OCC(=O)OCC(=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C21H22F3NO4/c1-20(2,3)15-9-5-7-11-17(15)28-13-19(27)29-12-18(26)25-16-10-6-4-8-14(16)21(22,23)24/h4-11H,12-13H2,1-3H3,(H,25,26) |
| InChIKey | PJBJUWXZUJPPEB-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.40 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |