C17H23NO6 — CID 8701384
[2-(ethoxycarbonylamino)-2-oxoethyl] 2-(2-tert-butylphenoxy)acetate (PubChem CID 8701384) has the molecular formula C17H23NO6 and a molecular weight of 337.37 g/mol. Its IUPAC name is [2-(ethoxycarbonylamino)-2-oxoethyl] 2-(2-tert-butylphenoxy)acetate.
| Compound Name | [2-(ethoxycarbonylamino)-2-oxoethyl] 2-(2-tert-butylphenoxy)acetate |
|---|---|
| PubChem CID | 8701384 |
| Molecular Formula | C17H23NO6 |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | [2-(ethoxycarbonylamino)-2-oxoethyl] 2-(2-tert-butylphenoxy)acetate |
| SMILES | CCOC(=O)NC(=O)COC(=O)COc1ccccc1C(C)(C)C |
| InChI | InChI=1S/C17H23NO6/c1-5-22-16(21)18-14(19)10-24-15(20)11-23-13-9-7-6-8-12(13)17(2,3)4/h6-9H,5,10-11H2,1-4H3,(H,18,19,21) |
| InChIKey | YUCIYWVIOTZWPG-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |