C16H21NO7 — CID 7856618
[2-(ethoxycarbonylamino)-2-oxoethyl] 3-(2-ethoxyphenoxy)propanoate (PubChem CID 7856618) has the molecular formula C16H21NO7 and a molecular weight of 339.34 g/mol. Its IUPAC name is [2-(ethoxycarbonylamino)-2-oxoethyl] 3-(2-ethoxyphenoxy)propanoate.
| Compound Name | [2-(ethoxycarbonylamino)-2-oxoethyl] 3-(2-ethoxyphenoxy)propanoate |
|---|---|
| PubChem CID | 7856618 |
| Molecular Formula | C16H21NO7 |
| Molecular Weight | 339.34 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | [2-(ethoxycarbonylamino)-2-oxoethyl] 3-(2-ethoxyphenoxy)propanoate |
| SMILES | CCOC(=O)NC(=O)COC(=O)CCOc1ccccc1OCC |
| InChI | InChI=1S/C16H21NO7/c1-3-21-12-7-5-6-8-13(12)23-10-9-15(19)24-11-14(18)17-16(20)22-4-2/h5-8H,3-4,9-11H2,1-2H3,(H,17,18,20) |
| InChIKey | XXEUATJKNZMXNO-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.34 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |