C21H23NO6 — CID 7147638
(2-benzamido-2-oxoethyl) 4-(2-ethoxyphenoxy)butanoate (PubChem CID 7147638) has the molecular formula C21H23NO6 and a molecular weight of 385.42 g/mol. Its IUPAC name is (2-benzamido-2-oxoethyl) 4-(2-ethoxyphenoxy)butanoate.
| Compound Name | (2-benzamido-2-oxoethyl) 4-(2-ethoxyphenoxy)butanoate |
|---|---|
| PubChem CID | 7147638 |
| Molecular Formula | C21H23NO6 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | (2-benzamido-2-oxoethyl) 4-(2-ethoxyphenoxy)butanoate |
| SMILES | CCOc1ccccc1OCCCC(=O)OCC(=O)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H23NO6/c1-2-26-17-11-6-7-12-18(17)27-14-8-13-20(24)28-15-19(23)22-21(25)16-9-4-3-5-10-16/h3-7,9-12H,2,8,13-15H2,1H3,(H,22,23,25) |
| InChIKey | MTRXXURPMSDLSC-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|