C24H27NO6 — CID 7222142
(2-benzamido-2-oxoethyl) 4-oxo-4-(4-pentoxyphenyl)butanoate (PubChem CID 7222142) has the molecular formula C24H27NO6 and a molecular weight of 425.48 g/mol. Its IUPAC name is (2-benzamido-2-oxoethyl) 4-oxo-4-(4-pentoxyphenyl)butanoate.
| Compound Name | (2-benzamido-2-oxoethyl) 4-oxo-4-(4-pentoxyphenyl)butanoate |
|---|---|
| PubChem CID | 7222142 |
| Molecular Formula | C24H27NO6 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | (2-benzamido-2-oxoethyl) 4-oxo-4-(4-pentoxyphenyl)butanoate |
| SMILES | CCCCCOc1ccc(C(=O)CCC(=O)OCC(=O)NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H27NO6/c1-2-3-7-16-30-20-12-10-18(11-13-20)21(26)14-15-23(28)31-17-22(27)25-24(29)19-8-5-4-6-9-19/h4-6,8-13H,2-3,7,14-17H2,1H3,(H,25,27,29) |
| InChIKey | MPJCTENACVCDCW-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|