C23H29NO5S — CID 42984941
[2-oxo-2-(1-thiophen-2-ylethylamino)ethyl] 4-oxo-4-(4-pentoxyphenyl)butanoate (PubChem CID 42984941) has the molecular formula C23H29NO5S and a molecular weight of 431.55 g/mol. Its IUPAC name is [2-oxo-2-(1-thiophen-2-ylethylamino)ethyl] 4-oxo-4-(4-pentoxyphenyl)butanoate.
| Compound Name | [2-oxo-2-(1-thiophen-2-ylethylamino)ethyl] 4-oxo-4-(4-pentoxyphenyl)butanoate |
|---|---|
| PubChem CID | 42984941 |
| Molecular Formula | C23H29NO5S |
| Molecular Weight | 431.55 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | [2-oxo-2-(1-thiophen-2-ylethylamino)ethyl] 4-oxo-4-(4-pentoxyphenyl)butanoate |
| SMILES | CCCCCOc1ccc(C(=O)CCC(=O)OCC(=O)NC(C)c2cccs2)cc1 |
| InChI | InChI=1S/C23H29NO5S/c1-3-4-5-14-28-19-10-8-18(9-11-19)20(25)12-13-23(27)29-16-22(26)24-17(2)21-7-6-15-30-21/h6-11,15,17H,3-5,12-14,16H2,1-2H3,(H,24,26) |
| InChIKey | LPVDYXGZKGMBDD-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.55 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|