C24H27FN2O6 — CID 42966217
[2-[2-(2-fluorobenzoyl)hydrazinyl]-2-oxoethyl] 4-oxo-4-(4-pentoxyphenyl)butanoate (PubChem CID 42966217) has the molecular formula C24H27FN2O6 and a molecular weight of 458.49 g/mol. Its IUPAC name is [2-[2-(2-fluorobenzoyl)hydrazinyl]-2-oxoethyl] 4-oxo-4-(4-pentoxyphenyl)butanoate.
| Compound Name | [2-[2-(2-fluorobenzoyl)hydrazinyl]-2-oxoethyl] 4-oxo-4-(4-pentoxyphenyl)butanoate |
|---|---|
| PubChem CID | 42966217 |
| Molecular Formula | C24H27FN2O6 |
| Molecular Weight | 458.49 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | [2-[2-(2-fluorobenzoyl)hydrazinyl]-2-oxoethyl] 4-oxo-4-(4-pentoxyphenyl)butanoate |
| SMILES | CCCCCOc1ccc(C(=O)CCC(=O)OCC(=O)NNC(=O)c2ccccc2F)cc1 |
| InChI | InChI=1S/C24H27FN2O6/c1-2-3-6-15-32-18-11-9-17(10-12-18)21(28)13-14-23(30)33-16-22(29)26-27-24(31)19-7-4-5-8-20(19)25/h4-5,7-12H,2-3,6,13-16H2,1H3,(H,26,29)(H,27,31) |
| InChIKey | TWVDGEZOEMHSIF-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.49 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|