C21H24N2O4 — CID 9220935
2-methyl-N'-[4-oxo-4-(4-propoxyphenyl)butanoyl]benzohydrazide (PubChem CID 9220935) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is 2-methyl-N'-[4-oxo-4-(4-propoxyphenyl)butanoyl]benzohydrazide.
| Compound Name | 2-methyl-N'-[4-oxo-4-(4-propoxyphenyl)butanoyl]benzohydrazide |
|---|---|
| PubChem CID | 9220935 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 2-methyl-N'-[4-oxo-4-(4-propoxyphenyl)butanoyl]benzohydrazide |
| SMILES | CCCOc1ccc(C(=O)CCC(=O)NNC(=O)c2ccccc2C)cc1 |
| InChI | InChI=1S/C21H24N2O4/c1-3-14-27-17-10-8-16(9-11-17)19(24)12-13-20(25)22-23-21(26)18-7-5-4-6-15(18)2/h4-11H,3,12-14H2,1-2H3,(H,22,25)(H,23,26) |
| InChIKey | YLGTWVXUUNNRMG-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|