C20H22N4O4 — CID 4630875
1-N',4-N'-bis(2-methylbenzoyl)butanedihydrazide (PubChem CID 4630875) has the molecular formula C20H22N4O4 and a molecular weight of 382.42 g/mol. Its IUPAC name is 1-N',4-N'-bis(2-methylbenzoyl)butanedihydrazide.
| Compound Name | 1-N',4-N'-bis(2-methylbenzoyl)butanedihydrazide |
|---|---|
| PubChem CID | 4630875 |
| Molecular Formula | C20H22N4O4 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 1-N',4-N'-bis(2-methylbenzoyl)butanedihydrazide |
| SMILES | Cc1ccccc1C(=O)NNC(=O)CCC(=O)NNC(=O)c1ccccc1C |
| InChI | InChI=1S/C20H22N4O4/c1-13-7-3-5-9-15(13)19(27)23-21-17(25)11-12-18(26)22-24-20(28)16-10-6-4-8-14(16)2/h3-10H,11-12H2,1-2H3,(H,21,25)(H,22,26)(H,23,27)(H,24,28) |
| InChIKey | BGQRABDPWMMIOU-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|