C18H18Cl2N2O2 — CID 55822719
N'-[4-(3,4-dichlorophenyl)butanoyl]-2-methylbenzohydrazide (PubChem CID 55822719) has the molecular formula C18H18Cl2N2O2 and a molecular weight of 365.26 g/mol. Its IUPAC name is N'-[4-(3,4-dichlorophenyl)butanoyl]-2-methylbenzohydrazide.
| Compound Name | N'-[4-(3,4-dichlorophenyl)butanoyl]-2-methylbenzohydrazide |
|---|---|
| PubChem CID | 55822719 |
| Molecular Formula | C18H18Cl2N2O2 |
| Molecular Weight | 365.26 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | N'-[4-(3,4-dichlorophenyl)butanoyl]-2-methylbenzohydrazide |
| SMILES | Cc1ccccc1C(=O)NNC(=O)CCCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H18Cl2N2O2/c1-12-5-2-3-7-14(12)18(24)22-21-17(23)8-4-6-13-9-10-15(19)16(20)11-13/h2-3,5,7,9-11H,4,6,8H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | LZLAPBUYYVBCDU-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.26 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|