C18H20Cl2N2O — CID 54544701
N'-benzyl-5-(3,4-dichlorophenyl)pentanehydrazide (PubChem CID 54544701) has the molecular formula C18H20Cl2N2O and a molecular weight of 351.28 g/mol. Its IUPAC name is N'-benzyl-5-(3,4-dichlorophenyl)pentanehydrazide.
| Compound Name | N'-benzyl-5-(3,4-dichlorophenyl)pentanehydrazide |
|---|---|
| PubChem CID | 54544701 |
| Molecular Formula | C18H20Cl2N2O |
| Molecular Weight | 351.28 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | N'-benzyl-5-(3,4-dichlorophenyl)pentanehydrazide |
| SMILES | O=C(CCCCc1ccc(Cl)c(Cl)c1)NNCc1ccccc1 |
| InChI | InChI=1S/C18H20Cl2N2O/c19-16-11-10-14(12-17(16)20)6-4-5-9-18(23)22-21-13-15-7-2-1-3-8-15/h1-3,7-8,10-12,21H,4-6,9,13H2,(H,22,23) |
| InChIKey | ZFSHAMMLTBQTBK-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.28 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|