C9H8Cl2N2O3 — CID 146586124
[[2-(3,4-dichlorophenyl)acetyl]amino]carbamic acid (PubChem CID 146586124) has the molecular formula C9H8Cl2N2O3 and a molecular weight of 263.08 g/mol. Its IUPAC name is [[2-(3,4-dichlorophenyl)acetyl]amino]carbamic acid.
| Compound Name | [[2-(3,4-dichlorophenyl)acetyl]amino]carbamic acid |
|---|---|
| PubChem CID | 146586124 |
| Molecular Formula | C9H8Cl2N2O3 |
| Molecular Weight | 263.08 g/mol |
| Exact Mass | 261.99 |
| IUPAC Name | [[2-(3,4-dichlorophenyl)acetyl]amino]carbamic acid |
| SMILES | O=C(O)NNC(=O)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C9H8Cl2N2O3/c10-6-2-1-5(3-7(6)11)4-8(14)12-13-9(15)16/h1-3,13H,4H2,(H,12,14)(H,15,16) |
| InChIKey | FROZCNBHGCXHDY-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.08 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|