C20H22Cl2N2O3 — CID 2434922
2-(3,4-dichlorophenyl)-N'-[2-(5-methyl-2-propan-2-ylphenoxy)acetyl]acetohydrazide (PubChem CID 2434922) has the molecular formula C20H22Cl2N2O3 and a molecular weight of 409.31 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-N'-[2-(5-methyl-2-propan-2-ylphenoxy)acetyl]acetohydrazide.
| Compound Name | 2-(3,4-dichlorophenyl)-N'-[2-(5-methyl-2-propan-2-ylphenoxy)acetyl]acetohydrazide |
|---|---|
| PubChem CID | 2434922 |
| Molecular Formula | C20H22Cl2N2O3 |
| Molecular Weight | 409.31 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-N'-[2-(5-methyl-2-propan-2-ylphenoxy)acetyl]acetohydrazide |
| SMILES | Cc1ccc(C(C)C)c(OCC(=O)NNC(=O)Cc2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C20H22Cl2N2O3/c1-12(2)15-6-4-13(3)8-18(15)27-11-20(26)24-23-19(25)10-14-5-7-16(21)17(22)9-14/h4-9,12H,10-11H2,1-3H3,(H,23,25)(H,24,26) |
| InChIKey | HBNDMTKNPXESNT-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.31 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|