C23H25N3O3S — CID 35001469
N'-[2-(5-methyl-2-propan-2-ylphenoxy)acetyl]-2-(2-phenyl-1,3-thiazol-4-yl)acetohydrazide (PubChem CID 35001469) has the molecular formula C23H25N3O3S and a molecular weight of 423.54 g/mol. Its IUPAC name is N'-[2-(5-methyl-2-propan-2-ylphenoxy)acetyl]-2-(2-phenyl-1,3-thiazol-4-yl)acetohydrazide.
| Compound Name | N'-[2-(5-methyl-2-propan-2-ylphenoxy)acetyl]-2-(2-phenyl-1,3-thiazol-4-yl)acetohydrazide |
|---|---|
| PubChem CID | 35001469 |
| Molecular Formula | C23H25N3O3S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | N'-[2-(5-methyl-2-propan-2-ylphenoxy)acetyl]-2-(2-phenyl-1,3-thiazol-4-yl)acetohydrazide |
| SMILES | Cc1ccc(C(C)C)c(OCC(=O)NNC(=O)Cc2csc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C23H25N3O3S/c1-15(2)19-10-9-16(3)11-20(19)29-13-22(28)26-25-21(27)12-18-14-30-23(24-18)17-7-5-4-6-8-17/h4-11,14-15H,12-13H2,1-3H3,(H,25,27)(H,26,28) |
| InChIKey | YJPAEKJNCUJHEP-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|