C25H34N2O3 — CID 54782202
N'-[2-(5-methyl-2-propan-2-ylphenoxy)acetyl]-2-[4-(2-methylpropyl)phenyl]propanehydrazide (PubChem CID 54782202) has the molecular formula C25H34N2O3 and a molecular weight of 410.56 g/mol. Its IUPAC name is N'-[2-(5-methyl-2-propan-2-ylphenoxy)acetyl]-2-[4-(2-methylpropyl)phenyl]propanehydrazide.
| Compound Name | N'-[2-(5-methyl-2-propan-2-ylphenoxy)acetyl]-2-[4-(2-methylpropyl)phenyl]propanehydrazide |
|---|---|
| PubChem CID | 54782202 |
| Molecular Formula | C25H34N2O3 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.26 |
| IUPAC Name | N'-[2-(5-methyl-2-propan-2-ylphenoxy)acetyl]-2-[4-(2-methylpropyl)phenyl]propanehydrazide |
| SMILES | Cc1ccc(C(C)C)c(OCC(=O)NNC(=O)C(C)c2ccc(CC(C)C)cc2)c1 |
| InChI | InChI=1S/C25H34N2O3/c1-16(2)13-20-8-10-21(11-9-20)19(6)25(29)27-26-24(28)15-30-23-14-18(5)7-12-22(23)17(3)4/h7-12,14,16-17,19H,13,15H2,1-6H3,(H,26,28)(H,27,29) |
| InChIKey | MDJYKONYVNNPJJ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|