C25H33BrN2O3 — CID 54782147
N'-[2-(2-bromo-4-tert-butylphenoxy)acetyl]-2-[4-(2-methylpropyl)phenyl]propanehydrazide (PubChem CID 54782147) has the molecular formula C25H33BrN2O3 and a molecular weight of 489.45 g/mol. Its IUPAC name is N'-[2-(2-bromo-4-tert-butylphenoxy)acetyl]-2-[4-(2-methylpropyl)phenyl]propanehydrazide.
| Compound Name | N'-[2-(2-bromo-4-tert-butylphenoxy)acetyl]-2-[4-(2-methylpropyl)phenyl]propanehydrazide |
|---|---|
| PubChem CID | 54782147 |
| Molecular Formula | C25H33BrN2O3 |
| Molecular Weight | 489.45 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | N'-[2-(2-bromo-4-tert-butylphenoxy)acetyl]-2-[4-(2-methylpropyl)phenyl]propanehydrazide |
| SMILES | CC(C)Cc1ccc(C(C)C(=O)NNC(=O)COc2ccc(C(C)(C)C)cc2Br)cc1 |
| InChI | InChI=1S/C25H33BrN2O3/c1-16(2)13-18-7-9-19(10-8-18)17(3)24(30)28-27-23(29)15-31-22-12-11-20(14-21(22)26)25(4,5)6/h7-12,14,16-17H,13,15H2,1-6H3,(H,27,29)(H,28,30) |
| InChIKey | FYGLOJPKRPKHPG-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.45 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|