C22H27BrN2O4 — CID 4922319
N'-[2-(2-bromo-4-tert-butylphenoxy)acetyl]-2-(2,4-dimethylphenoxy)acetohydrazide (PubChem CID 4922319) has the molecular formula C22H27BrN2O4 and a molecular weight of 463.37 g/mol. Its IUPAC name is N'-[2-(2-bromo-4-tert-butylphenoxy)acetyl]-2-(2,4-dimethylphenoxy)acetohydrazide.
| Compound Name | N'-[2-(2-bromo-4-tert-butylphenoxy)acetyl]-2-(2,4-dimethylphenoxy)acetohydrazide |
|---|---|
| PubChem CID | 4922319 |
| Molecular Formula | C22H27BrN2O4 |
| Molecular Weight | 463.37 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | N'-[2-(2-bromo-4-tert-butylphenoxy)acetyl]-2-(2,4-dimethylphenoxy)acetohydrazide |
| SMILES | Cc1ccc(OCC(=O)NNC(=O)COc2ccc(C(C)(C)C)cc2Br)c(C)c1 |
| InChI | InChI=1S/C22H27BrN2O4/c1-14-6-8-18(15(2)10-14)28-12-20(26)24-25-21(27)13-29-19-9-7-16(11-17(19)23)22(3,4)5/h6-11H,12-13H2,1-5H3,(H,24,26)(H,25,27) |
| InChIKey | OVKAJTSKAWVPDD-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.37 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|