C21H25BrN2O4 — CID 4940151
N'-[2-(2-bromo-4-tert-butylphenoxy)acetyl]-2-phenoxypropanehydrazide (PubChem CID 4940151) has the molecular formula C21H25BrN2O4 and a molecular weight of 449.35 g/mol. Its IUPAC name is N'-[2-(2-bromo-4-tert-butylphenoxy)acetyl]-2-phenoxypropanehydrazide.
| Compound Name | N'-[2-(2-bromo-4-tert-butylphenoxy)acetyl]-2-phenoxypropanehydrazide |
|---|---|
| PubChem CID | 4940151 |
| Molecular Formula | C21H25BrN2O4 |
| Molecular Weight | 449.35 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | N'-[2-(2-bromo-4-tert-butylphenoxy)acetyl]-2-phenoxypropanehydrazide |
| SMILES | CC(Oc1ccccc1)C(=O)NNC(=O)COc1ccc(C(C)(C)C)cc1Br |
| InChI | InChI=1S/C21H25BrN2O4/c1-14(28-16-8-6-5-7-9-16)20(26)24-23-19(25)13-27-18-11-10-15(12-17(18)22)21(2,3)4/h5-12,14H,13H2,1-4H3,(H,23,25)(H,24,26) |
| InChIKey | TVXSJFJRRKRBLA-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.35 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|