C14H18Cl2N2O2 — CID 47286286
N-(4-amino-4-oxobutyl)-4-(3,4-dichlorophenyl)butanamide (PubChem CID 47286286) has the molecular formula C14H18Cl2N2O2 and a molecular weight of 317.22 g/mol. Its IUPAC name is N-(4-amino-4-oxobutyl)-4-(3,4-dichlorophenyl)butanamide.
| Compound Name | N-(4-amino-4-oxobutyl)-4-(3,4-dichlorophenyl)butanamide |
|---|---|
| PubChem CID | 47286286 |
| Molecular Formula | C14H18Cl2N2O2 |
| Molecular Weight | 317.22 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | N-(4-amino-4-oxobutyl)-4-(3,4-dichlorophenyl)butanamide |
| SMILES | NC(=O)CCCNC(=O)CCCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H18Cl2N2O2/c15-11-7-6-10(9-12(11)16)3-1-5-14(20)18-8-2-4-13(17)19/h6-7,9H,1-5,8H2,(H2,17,19)(H,18,20) |
| InChIKey | LWWKMQGSESIBAR-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.22 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|