C19H22Cl2N2O3S — CID 123145328
N-[3-(3,4-dichlorophenyl)propyl]-3-[4-(methylamino)phenyl]propanamide;sulfur dioxide (PubChem CID 123145328) has the molecular formula C19H22Cl2N2O3S and a molecular weight of 429.37 g/mol. Its IUPAC name is N-[3-(3,4-dichlorophenyl)propyl]-3-[4-(methylamino)phenyl]propanamide;sulfur dioxide.
| Compound Name | N-[3-(3,4-dichlorophenyl)propyl]-3-[4-(methylamino)phenyl]propanamide;sulfur dioxide |
|---|---|
| PubChem CID | 123145328 |
| Molecular Formula | C19H22Cl2N2O3S |
| Molecular Weight | 429.37 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | N-[3-(3,4-dichlorophenyl)propyl]-3-[4-(methylamino)phenyl]propanamide;sulfur dioxide |
| SMILES | CNc1ccc(CCC(=O)NCCCc2ccc(Cl)c(Cl)c2)cc1.O=S=O |
| InChI | InChI=1S/C19H22Cl2N2O.O2S/c1-22-16-8-4-14(5-9-16)7-11-19(24)23-12-2-3-15-6-10-17(20)18(21)13-15;1-3-2/h4-6,8-10,13,22H,2-3,7,11-12H2,1H3,(H,23,24); |
| InChIKey | OISKOTKHMXMXRY-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.37 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|