C14H19Cl2NO — CID 100573076
3-(3,4-dichlorophenyl)-N-[(2R)-3-methylbutan-2-yl]propanamide (PubChem CID 100573076) has the molecular formula C14H19Cl2NO and a molecular weight of 288.22 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-N-[(2R)-3-methylbutan-2-yl]propanamide.
| Compound Name | 3-(3,4-dichlorophenyl)-N-[(2R)-3-methylbutan-2-yl]propanamide |
|---|---|
| PubChem CID | 100573076 |
| Molecular Formula | C14H19Cl2NO |
| Molecular Weight | 288.22 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-N-[(2R)-3-methylbutan-2-yl]propanamide |
| SMILES | CC(C)[C@@H](C)NC(=O)CCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H19Cl2NO/c1-9(2)10(3)17-14(18)7-5-11-4-6-12(15)13(16)8-11/h4,6,8-10H,5,7H2,1-3H3,(H,17,18)/t10-/m1/s1 |
| InChIKey | XNTTYKBYKMWWFP-SNVBAGLBSA-N |
| XLogP | 4.09 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.22 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |