C18H19Cl2NO — CID 100597681
3-(3,4-dichlorophenyl)-N-[(1R)-1-(2-methylphenyl)ethyl]propanamide (PubChem CID 100597681) has the molecular formula C18H19Cl2NO and a molecular weight of 336.26 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-N-[(1R)-1-(2-methylphenyl)ethyl]propanamide.
| Compound Name | 3-(3,4-dichlorophenyl)-N-[(1R)-1-(2-methylphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 100597681 |
| Molecular Formula | C18H19Cl2NO |
| Molecular Weight | 336.26 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-N-[(1R)-1-(2-methylphenyl)ethyl]propanamide |
| SMILES | Cc1ccccc1[C@@H](C)NC(=O)CCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H19Cl2NO/c1-12-5-3-4-6-15(12)13(2)21-18(22)10-8-14-7-9-16(19)17(20)11-14/h3-7,9,11,13H,8,10H2,1-2H3,(H,21,22)/t13-/m1/s1 |
| InChIKey | NXVGRPXJXYYMBG-CYBMUJFWSA-N |
| XLogP | 5.11 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.26 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |