2-[3-(3,4-dichlorophenyl)propanoylamino]propanoic acid

C12H13Cl2NO3 — CID 119225556

IUPAC2-[3-(3,4-dichlorophenyl)propanoylamino]propanoic acid
SMILESCC(NC(=O)CCc1ccc(Cl)c(Cl)c1)C(=O)O
InChIInChI=1S/C12H13Cl2NO3/c1-7(12(17)18)15-11(16)5-3-8-2-4-9(13)10(14)6-8/h2,4,6-7H,3,5H2,1H3,(H,15,16)(H,17,18)
InChIKeyAOPFDFFGBGIICH-UHFFFAOYSA-N
MW290.15 g/mol
LogP2.52
Rot. Bonds5

About 2-[3-(3,4-dichlorophenyl)propanoylamino]propanoic acid

2-[3-(3,4-dichlorophenyl)propanoylamino]propanoic acid (PubChem CID 119225556) has the molecular formula C12H13Cl2NO3 and a molecular weight of 290.15 g/mol. Its IUPAC name is 2-[3-(3,4-dichlorophenyl)propanoylamino]propanoic acid.

Molecular Properties

Compound Name2-[3-(3,4-dichlorophenyl)propanoylamino]propanoic acid
PubChem CID119225556
Molecular FormulaC12H13Cl2NO3
Molecular Weight290.15 g/mol
Exact Mass289.03
IUPAC Name2-[3-(3,4-dichlorophenyl)propanoylamino]propanoic acid
SMILESCC(NC(=O)CCc1ccc(Cl)c(Cl)c1)C(=O)O
InChIInChI=1S/C12H13Cl2NO3/c1-7(12(17)18)15-11(16)5-3-8-2-4-9(13)10(14)6-8/h2,4,6-7H,3,5H2,1H3,(H,15,16)(H,17,18)
InChIKeyAOPFDFFGBGIICH-UHFFFAOYSA-N
XLogP2.52
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500290.15
LogP ≤ 52.52
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-[3-(3,4-dichlorophenyl)propanoylamino]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[3-(3,4-dichlorophenyl)propanoylamino]propanoic acid?
The IUPAC name of 2-[3-(3,4-dichlorophenyl)propanoylamino]propanoic acid (CID 119225556) is 2-[3-(3,4-dichlorophenyl)propanoylamino]propanoic acid.
What is the SMILES notation for 2-[3-(3,4-dichlorophenyl)propanoylamino]propanoic acid?
The canonical SMILES for 2-[3-(3,4-dichlorophenyl)propanoylamino]propanoic acid is CC(NC(=O)CCc1ccc(Cl)c(Cl)c1)C(=O)O.
What is the InChIKey of 2-[3-(3,4-dichlorophenyl)propanoylamino]propanoic acid?
The InChIKey is AOPFDFFGBGIICH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13Cl2NO3/c1-7(12(17)18)15-11(16)5-3-8-2-4-9(13)10(14)6-8/h2,4,6-7H,3,5H2,1H3,(H,15,16)(H,17,18).
What are the key properties of 2-[3-(3,4-dichlorophenyl)propanoylamino]propanoic acid?
2-[3-(3,4-dichlorophenyl)propanoylamino]propanoic acid has a molecular weight of 290.15 g/mol, XLogP of 2.52, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(3,4-dichlorophenyl)propanoylamino]propanoic acid is sourced from PubChem (CID 119225556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).