C17H14Cl4O — CID 70057291
1,5-bis(3,4-dichlorophenyl)pentan-3-one (PubChem CID 70057291) has the molecular formula C17H14Cl4O and a molecular weight of 376.11 g/mol. Its IUPAC name is 1,5-bis(3,4-dichlorophenyl)pentan-3-one.
| Compound Name | 1,5-bis(3,4-dichlorophenyl)pentan-3-one |
|---|---|
| PubChem CID | 70057291 |
| Molecular Formula | C17H14Cl4O |
| Molecular Weight | 376.11 g/mol |
| Exact Mass | 373.98 |
| IUPAC Name | 1,5-bis(3,4-dichlorophenyl)pentan-3-one |
| SMILES | O=C(CCc1ccc(Cl)c(Cl)c1)CCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H14Cl4O/c18-14-7-3-11(9-16(14)20)1-5-13(22)6-2-12-4-8-15(19)17(21)10-12/h3-4,7-10H,1-2,5-6H2 |
| InChIKey | UUFONDNVECNAAW-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.11 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |