C14H20Cl2N2O — CID 145472486
3-(3,4-dichlorophenyl)-1-pyrrolidin-1-ylpropan-1-one;methanamine (PubChem CID 145472486) has the molecular formula C14H20Cl2N2O and a molecular weight of 303.23 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-1-pyrrolidin-1-ylpropan-1-one;methanamine.
| Compound Name | 3-(3,4-dichlorophenyl)-1-pyrrolidin-1-ylpropan-1-one;methanamine |
|---|---|
| PubChem CID | 145472486 |
| Molecular Formula | C14H20Cl2N2O |
| Molecular Weight | 303.23 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-1-pyrrolidin-1-ylpropan-1-one;methanamine |
| SMILES | CN.O=C(CCc1ccc(Cl)c(Cl)c1)N1CCCC1 |
| InChI | InChI=1S/C13H15Cl2NO.CH5N/c14-11-5-3-10(9-12(11)15)4-6-13(17)16-7-1-2-8-16;1-2/h3,5,9H,1-2,4,6-8H2;2H2,1H3 |
| InChIKey | YKDXHMVBNNUMNH-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.23 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |