C12H13Cl2NO — CID 10422618
2-(3,4-dichlorophenyl)-1-pyrrolidin-1-ylethanone (PubChem CID 10422618) has the molecular formula C12H13Cl2NO and a molecular weight of 258.15 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-1-pyrrolidin-1-ylethanone.
| Compound Name | 2-(3,4-dichlorophenyl)-1-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 10422618 |
| Molecular Formula | C12H13Cl2NO |
| Molecular Weight | 258.15 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-1-pyrrolidin-1-ylethanone |
| SMILES | O=C(Cc1ccc(Cl)c(Cl)c1)N1CCCC1 |
| InChI | InChI=1S/C12H13Cl2NO/c13-10-4-3-9(7-11(10)14)8-12(16)15-5-1-2-6-15/h3-4,7H,1-2,5-6,8H2 |
| InChIKey | RSHOZJYFYCCZOX-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.15 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |