C12H15Cl2N3O3S — CID 63046673
4-[2-(3,4-dichlorophenyl)acetyl]piperazine-1-sulfonamide (PubChem CID 63046673) has the molecular formula C12H15Cl2N3O3S and a molecular weight of 352.24 g/mol. Its IUPAC name is 4-[2-(3,4-dichlorophenyl)acetyl]piperazine-1-sulfonamide.
| Compound Name | 4-[2-(3,4-dichlorophenyl)acetyl]piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 63046673 |
| Molecular Formula | C12H15Cl2N3O3S |
| Molecular Weight | 352.24 g/mol |
| Exact Mass | 351.02 |
| IUPAC Name | 4-[2-(3,4-dichlorophenyl)acetyl]piperazine-1-sulfonamide |
| SMILES | NS(=O)(=O)N1CCN(C(=O)Cc2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C12H15Cl2N3O3S/c13-10-2-1-9(7-11(10)14)8-12(18)16-3-5-17(6-4-16)21(15,19)20/h1-2,7H,3-6,8H2,(H2,15,19,20) |
| InChIKey | QZGCEOXIHDYWLF-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.24 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |