C12H17N3O4S — CID 61399968
4-[2-(3-hydroxyphenyl)acetyl]piperazine-1-sulfonamide (PubChem CID 61399968) has the molecular formula C12H17N3O4S and a molecular weight of 299.35 g/mol. Its IUPAC name is 4-[2-(3-hydroxyphenyl)acetyl]piperazine-1-sulfonamide.
| Compound Name | 4-[2-(3-hydroxyphenyl)acetyl]piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 61399968 |
| Molecular Formula | C12H17N3O4S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 4-[2-(3-hydroxyphenyl)acetyl]piperazine-1-sulfonamide |
| SMILES | NS(=O)(=O)N1CCN(C(=O)Cc2cccc(O)c2)CC1 |
| InChI | InChI=1S/C12H17N3O4S/c13-20(18,19)15-6-4-14(5-7-15)12(17)9-10-2-1-3-11(16)8-10/h1-3,8,16H,4-7,9H2,(H2,13,18,19) |
| InChIKey | RLADNTBDUVPVFL-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 103.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |