C13H19N3O3S — CID 62499024
2-(3-aminophenyl)-1-(4-methylsulfonylpiperazin-1-yl)ethanone (PubChem CID 62499024) has the molecular formula C13H19N3O3S and a molecular weight of 297.38 g/mol. Its IUPAC name is 2-(3-aminophenyl)-1-(4-methylsulfonylpiperazin-1-yl)ethanone.
| Compound Name | 2-(3-aminophenyl)-1-(4-methylsulfonylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 62499024 |
| Molecular Formula | C13H19N3O3S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 2-(3-aminophenyl)-1-(4-methylsulfonylpiperazin-1-yl)ethanone |
| SMILES | CS(=O)(=O)N1CCN(C(=O)Cc2cccc(N)c2)CC1 |
| InChI | InChI=1S/C13H19N3O3S/c1-20(18,19)16-7-5-15(6-8-16)13(17)10-11-3-2-4-12(14)9-11/h2-4,9H,5-8,10,14H2,1H3 |
| InChIKey | XEOIPJWJSYDKAN-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|